C20H23N3O4 — CID 163130137
(3R,5S,9S)-11-benzoyl-5-prop-2-enoxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione (PubChem CID 163130137) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is (3R,5S,9S)-11-benzoyl-5-prop-2-enoxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione.
| Compound Name | (3R,5S,9S)-11-benzoyl-5-prop-2-enoxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
|---|---|
| PubChem CID | 163130137 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (3R,5S,9S)-11-benzoyl-5-prop-2-enoxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
| SMILES | C=CCO[C@H]1C[C@@H]2C(=O)N3CCN(C(=O)c4ccccc4)C[C@H]3C(=O)N2C1 |
| InChI | InChI=1S/C20H23N3O4/c1-2-10-27-15-11-16-19(25)22-9-8-21(13-17(22)20(26)23(16)12-15)18(24)14-6-4-3-5-7-14/h2-7,15-17H,1,8-13H2/t15-,16+,17-/m0/s1 |
| InChIKey | FVFFRMJBUKINGR-BBWFWOEESA-N |
| XLogP | 0.53 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|