C21H19N3O4 — CID 163175009
(8aR)-2-(4-acetylphenyl)-7-benzoyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 163175009) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is (8aR)-2-(4-acetylphenyl)-7-benzoyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | (8aR)-2-(4-acetylphenyl)-7-benzoyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 163175009 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (8aR)-2-(4-acetylphenyl)-7-benzoyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@H]3CN(C(=O)c4ccccc4)CCN3C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O4/c1-14(25)15-7-9-17(10-8-15)24-20(27)18-13-22(11-12-23(18)21(24)28)19(26)16-5-3-2-4-6-16/h2-10,18H,11-13H2,1H3/t18-/m1/s1 |
| InChIKey | WXKUGLMKVBCEJZ-GOSISDBHSA-N |
| XLogP | 2.18 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|