C20H18FN3O4 — CID 163161577
(8aS)-7-(3-fluorobenzoyl)-2-(3-methoxyphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 163161577) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is (8aS)-7-(3-fluorobenzoyl)-2-(3-methoxyphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | (8aS)-7-(3-fluorobenzoyl)-2-(3-methoxyphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 163161577 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (8aS)-7-(3-fluorobenzoyl)-2-(3-methoxyphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | COc1cccc(N2C(=O)[C@@H]3CN(C(=O)c4cccc(F)c4)CCN3C2=O)c1 |
| InChI | InChI=1S/C20H18FN3O4/c1-28-16-7-3-6-15(11-16)24-19(26)17-12-22(8-9-23(17)20(24)27)18(25)13-4-2-5-14(21)10-13/h2-7,10-11,17H,8-9,12H2,1H3/t17-/m0/s1 |
| InChIKey | REZLUVTUNXWVFX-KRWDZBQOSA-N |
| XLogP | 2.13 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|