C20H20N4O4 — CID 163121674
(8aS)-2-(3-methoxyphenyl)-1,3-dioxo-N-phenyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide (PubChem CID 163121674) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is (8aS)-2-(3-methoxyphenyl)-1,3-dioxo-N-phenyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide.
| Compound Name | (8aS)-2-(3-methoxyphenyl)-1,3-dioxo-N-phenyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 163121674 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (8aS)-2-(3-methoxyphenyl)-1,3-dioxo-N-phenyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
| SMILES | COc1cccc(N2C(=O)[C@@H]3CN(C(=O)Nc4ccccc4)CCN3C2=O)c1 |
| InChI | InChI=1S/C20H20N4O4/c1-28-16-9-5-8-15(12-16)24-18(25)17-13-22(10-11-23(17)20(24)27)19(26)21-14-6-3-2-4-7-14/h2-9,12,17H,10-11,13H2,1H3,(H,21,26)/t17-/m0/s1 |
| InChIKey | BSWFYCAJDBZOCX-KRWDZBQOSA-N |
| XLogP | 2.38 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|