C16H20N4O4 — CID 163129765
(7R,9aS)-N-(3-methoxyphenyl)-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 163129765) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is (7R,9aS)-N-(3-methoxyphenyl)-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7R,9aS)-N-(3-methoxyphenyl)-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 163129765 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (7R,9aS)-N-(3-methoxyphenyl)-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCN3C(=O)[C@@H](C)NC(=O)[C@@H]3C2)c1 |
| InChI | InChI=1S/C16H20N4O4/c1-10-15(22)20-7-6-19(9-13(20)14(21)17-10)16(23)18-11-4-3-5-12(8-11)24-2/h3-5,8,10,13H,6-7,9H2,1-2H3,(H,17,21)(H,18,23)/t10-,13+/m1/s1 |
| InChIKey | FRNFTSKYUXBWPR-MFKMUULPSA-N |
| XLogP | 0.26 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |