C23H26N4O5 — CID 7161770
(7S,9aS)-N-(3-methoxyphenyl)-7-[(4-methoxyphenyl)methyl]-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 7161770) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is (7S,9aS)-N-(3-methoxyphenyl)-7-[(4-methoxyphenyl)methyl]-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7S,9aS)-N-(3-methoxyphenyl)-7-[(4-methoxyphenyl)methyl]-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 7161770 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (7S,9aS)-N-(3-methoxyphenyl)-7-[(4-methoxyphenyl)methyl]-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H]3CN(C(=O)Nc4cccc(OC)c4)CCN3C2=O)cc1 |
| InChI | InChI=1S/C23H26N4O5/c1-31-17-8-6-15(7-9-17)12-19-22(29)27-11-10-26(14-20(27)21(28)25-19)23(30)24-16-4-3-5-18(13-16)32-2/h3-9,13,19-20H,10-12,14H2,1-2H3,(H,24,30)(H,25,28)/t19-,20-/m0/s1 |
| InChIKey | PNWAHJZUAUZRPQ-PMACEKPBSA-N |
| XLogP | 1.49 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |