C18H23FN4O3 — CID 56852916
(7S,9aR)-7-[(2S)-butan-2-yl]-N-(3-fluorophenyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 56852916) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is (7S,9aR)-7-[(2S)-butan-2-yl]-N-(3-fluorophenyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7S,9aR)-7-[(2S)-butan-2-yl]-N-(3-fluorophenyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 56852916 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (7S,9aR)-7-[(2S)-butan-2-yl]-N-(3-fluorophenyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H]2CN(C(=O)Nc3cccc(F)c3)CCN2C1=O |
| InChI | InChI=1S/C18H23FN4O3/c1-3-11(2)15-17(25)23-8-7-22(10-14(23)16(24)21-15)18(26)20-13-6-4-5-12(19)9-13/h4-6,9,11,14-15H,3,7-8,10H2,1-2H3,(H,20,26)(H,21,24)/t11-,14+,15-/m0/s1 |
| InChIKey | FWBWRCRXKUYNNS-GLQYFDAESA-N |
| XLogP | 1.41 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |