C23H23F2N3O4 — CID 56860681
(7S,9aR)-2-(2,5-difluorobenzoyl)-7-[(1R)-1-phenylmethoxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56860681) has the molecular formula C23H23F2N3O4 and a molecular weight of 443.45 g/mol. Its IUPAC name is (7S,9aR)-2-(2,5-difluorobenzoyl)-7-[(1R)-1-phenylmethoxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-(2,5-difluorobenzoyl)-7-[(1R)-1-phenylmethoxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56860681 |
| Molecular Formula | C23H23F2N3O4 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (7S,9aR)-2-(2,5-difluorobenzoyl)-7-[(1R)-1-phenylmethoxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C[C@@H](OCc1ccccc1)[C@@H]1NC(=O)[C@H]2CN(C(=O)c3cc(F)ccc3F)CCN2C1=O |
| InChI | InChI=1S/C23H23F2N3O4/c1-14(32-13-15-5-3-2-4-6-15)20-23(31)28-10-9-27(12-19(28)21(29)26-20)22(30)17-11-16(24)7-8-18(17)25/h2-8,11,14,19-20H,9-10,12-13H2,1H3,(H,26,29)/t14-,19-,20+/m1/s1 |
| InChIKey | ZIQXEEBWPDLICC-XMCHAPAWSA-N |
| XLogP | 1.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |