C23H31N3O4 — CID 73134623
2-(cyclohexanecarbonyl)-7-(1-phenylmethoxyethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 73134623) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyl)-7-(1-phenylmethoxyethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2-(cyclohexanecarbonyl)-7-(1-phenylmethoxyethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 73134623 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 2-(cyclohexanecarbonyl)-7-(1-phenylmethoxyethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC(OCc1ccccc1)C1NC(=O)C2CN(C(=O)C3CCCCC3)CCN2C1=O |
| InChI | InChI=1S/C23H31N3O4/c1-16(30-15-17-8-4-2-5-9-17)20-23(29)26-13-12-25(14-19(26)21(27)24-20)22(28)18-10-6-3-7-11-18/h2,4-5,8-9,16,18-20H,3,6-7,10-15H2,1H3,(H,24,27) |
| InChIKey | SFBVCGNGEABGES-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |