C17H20Cl2N4O3 — CID 56856620
(7R,9aR)-N-(2,4-dichlorophenyl)-6,9-dioxo-7-propan-2-yl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 56856620) has the molecular formula C17H20Cl2N4O3 and a molecular weight of 399.28 g/mol. Its IUPAC name is (7R,9aR)-N-(2,4-dichlorophenyl)-6,9-dioxo-7-propan-2-yl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7R,9aR)-N-(2,4-dichlorophenyl)-6,9-dioxo-7-propan-2-yl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 56856620 |
| Molecular Formula | C17H20Cl2N4O3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (7R,9aR)-N-(2,4-dichlorophenyl)-6,9-dioxo-7-propan-2-yl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC(C)[C@H]1NC(=O)[C@H]2CN(C(=O)Nc3ccc(Cl)cc3Cl)CCN2C1=O |
| InChI | InChI=1S/C17H20Cl2N4O3/c1-9(2)14-16(25)23-6-5-22(8-13(23)15(24)21-14)17(26)20-12-4-3-10(18)7-11(12)19/h3-4,7,9,13-14H,5-6,8H2,1-2H3,(H,20,26)(H,21,24)/t13-,14-/m1/s1 |
| InChIKey | GCHDQHCDDNQTCC-ZIAGYGMSSA-N |
| XLogP | 2.19 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |