C19H20N4O3 — CID 146074011
8-(1-methylpyrrole-2-carbonyl)-2-phenyl-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione (PubChem CID 146074011) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 8-(1-methylpyrrole-2-carbonyl)-2-phenyl-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione.
| Compound Name | 8-(1-methylpyrrole-2-carbonyl)-2-phenyl-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 146074011 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 8-(1-methylpyrrole-2-carbonyl)-2-phenyl-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione |
| SMILES | Cn1cccc1C(=O)N1CCCN2C(=O)N(c3ccccc3)C(=O)C2C1 |
| InChI | InChI=1S/C19H20N4O3/c1-20-10-5-9-15(20)17(24)21-11-6-12-22-16(13-21)18(25)23(19(22)26)14-7-3-2-4-8-14/h2-5,7-10,16H,6,11-13H2,1H3 |
| InChIKey | LRZZWSSAECDGOU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|