C21H25N3O5 — CID 11887551
(3S,4R,9R)-11-(4-methoxybenzoyl)-4-prop-2-enoxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione (PubChem CID 11887551) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is (3S,4R,9R)-11-(4-methoxybenzoyl)-4-prop-2-enoxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione.
| Compound Name | (3S,4R,9R)-11-(4-methoxybenzoyl)-4-prop-2-enoxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
|---|---|
| PubChem CID | 11887551 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (3S,4R,9R)-11-(4-methoxybenzoyl)-4-prop-2-enoxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
| SMILES | C=CCO[C@@H]1CCN2C(=O)[C@H]3CN(C(=O)c4ccc(OC)cc4)CCN3C(=O)[C@H]12 |
| InChI | InChI=1S/C21H25N3O5/c1-3-12-29-17-8-9-24-18(17)21(27)23-11-10-22(13-16(23)20(24)26)19(25)14-4-6-15(28-2)7-5-14/h3-7,16-18H,1,8-13H2,2H3/t16-,17-,18+/m1/s1 |
| InChIKey | SXKOUHKPTGEEKB-KURKYZTESA-N |
| XLogP | 0.53 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|