C25H32N2O4 — CID 124998730
[(3R)-3-(2-methoxyphenyl)-4-methylpiperazin-1-yl]-[4-(4-methoxyphenyl)oxan-4-yl]methanone (PubChem CID 124998730) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is [(3R)-3-(2-methoxyphenyl)-4-methylpiperazin-1-yl]-[4-(4-methoxyphenyl)oxan-4-yl]methanone.
| Compound Name | [(3R)-3-(2-methoxyphenyl)-4-methylpiperazin-1-yl]-[4-(4-methoxyphenyl)oxan-4-yl]methanone |
|---|---|
| PubChem CID | 124998730 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [(3R)-3-(2-methoxyphenyl)-4-methylpiperazin-1-yl]-[4-(4-methoxyphenyl)oxan-4-yl]methanone |
| SMILES | COc1ccc(C2(C(=O)N3CCN(C)[C@H](c4ccccc4OC)C3)CCOCC2)cc1 |
| InChI | InChI=1S/C25H32N2O4/c1-26-14-15-27(18-22(26)21-6-4-5-7-23(21)30-3)24(28)25(12-16-31-17-13-25)19-8-10-20(29-2)11-9-19/h4-11,22H,12-18H2,1-3H3/t22-/m0/s1 |
| InChIKey | RJSVVXDDMVOKIC-QFIPXVFZSA-N |
| XLogP | 3.27 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |