C22H19F2N3O — CID 95093694
(4-fluorophenyl)-[(3S)-3-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]methanone (PubChem CID 95093694) has the molecular formula C22H19F2N3O and a molecular weight of 379.41 g/mol. Its IUPAC name is (4-fluorophenyl)-[(3S)-3-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[(3S)-3-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95093694 |
| Molecular Formula | C22H19F2N3O |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (4-fluorophenyl)-[(3S)-3-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCC[C@H](c2ccnc(-c3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C22H19F2N3O/c23-18-7-3-15(4-8-18)21-25-12-11-20(26-21)17-2-1-13-27(14-17)22(28)16-5-9-19(24)10-6-16/h3-12,17H,1-2,13-14H2/t17-/m0/s1 |
| InChIKey | FWLJWXMLVUBZLR-KRWDZBQOSA-N |
| XLogP | 4.44 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |