C22H19ClFN3O — CID 95093509
(3-chloro-4-fluorophenyl)-[(3R)-3-(2-phenylpyrimidin-4-yl)piperidin-1-yl]methanone (PubChem CID 95093509) has the molecular formula C22H19ClFN3O and a molecular weight of 395.87 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[(3R)-3-(2-phenylpyrimidin-4-yl)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[(3R)-3-(2-phenylpyrimidin-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95093509 |
| Molecular Formula | C22H19ClFN3O |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[(3R)-3-(2-phenylpyrimidin-4-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1)N1CCC[C@@H](c2ccnc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C22H19ClFN3O/c23-18-13-16(8-9-19(18)24)22(28)27-12-4-7-17(14-27)20-10-11-25-21(26-20)15-5-2-1-3-6-15/h1-3,5-6,8-11,13,17H,4,7,12,14H2/t17-/m1/s1 |
| InChIKey | WZDSLTIDSNVGIG-QGZVFWFLSA-N |
| XLogP | 4.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |