C22H27N3O — CID 95819177
cyclopentyl-[(3R)-3-[3-(3-methylphenyl)pyrazin-2-yl]piperidin-1-yl]methanone (PubChem CID 95819177) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is cyclopentyl-[(3R)-3-[3-(3-methylphenyl)pyrazin-2-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopentyl-[(3R)-3-[3-(3-methylphenyl)pyrazin-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95819177 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | cyclopentyl-[(3R)-3-[3-(3-methylphenyl)pyrazin-2-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cccc(-c2nccnc2[C@@H]2CCCN(C(=O)C3CCCC3)C2)c1 |
| InChI | InChI=1S/C22H27N3O/c1-16-6-4-9-18(14-16)20-21(24-12-11-23-20)19-10-5-13-25(15-19)22(26)17-7-2-3-8-17/h4,6,9,11-12,14,17,19H,2-3,5,7-8,10,13,15H2,1H3/t19-/m1/s1 |
| InChIKey | UDJGYJLRJWKBBX-LJQANCHMSA-N |
| XLogP | 4.35 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |