C24H30N2O — CID 95809983
cyclopentyl-[(3S)-3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone (PubChem CID 95809983) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is cyclopentyl-[(3S)-3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | cyclopentyl-[(3S)-3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95809983 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | cyclopentyl-[(3S)-3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone |
| SMILES | Cc1cccc(Cc2cccc([C@H]3CCCN(C(=O)C4CCCC4)C3)n2)c1 |
| InChI | InChI=1S/C24H30N2O/c1-18-7-4-8-19(15-18)16-22-12-5-13-23(25-22)21-11-6-14-26(17-21)24(27)20-9-2-3-10-20/h4-5,7-8,12-13,15,20-21H,2-3,6,9-11,14,16-17H2,1H3/t21-/m0/s1 |
| InChIKey | KLSASONOTRVRSD-NRFANRHFSA-N |
| XLogP | 4.88 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |