C23H28N2O — CID 110249572
cyclobutyl-[3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone (PubChem CID 110249572) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is cyclobutyl-[3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | cyclobutyl-[3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110249572 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | cyclobutyl-[3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone |
| SMILES | Cc1cccc(Cc2cccc(C3CCCN(C(=O)C4CCC4)C3)n2)c1 |
| InChI | InChI=1S/C23H28N2O/c1-17-6-2-7-18(14-17)15-21-11-4-12-22(24-21)20-10-5-13-25(16-20)23(26)19-8-3-9-19/h2,4,6-7,11-12,14,19-20H,3,5,8-10,13,15-16H2,1H3 |
| InChIKey | BWSVIXNCCNOYBT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |