C24H27N3 — CID 95809284
2-[(3-methylphenyl)methyl]-6-[(3S)-1-(pyridin-2-ylmethyl)piperidin-3-yl]pyridine (PubChem CID 95809284) has the molecular formula C24H27N3 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-6-[(3S)-1-(pyridin-2-ylmethyl)piperidin-3-yl]pyridine.
| Compound Name | 2-[(3-methylphenyl)methyl]-6-[(3S)-1-(pyridin-2-ylmethyl)piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 95809284 |
| Molecular Formula | C24H27N3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-6-[(3S)-1-(pyridin-2-ylmethyl)piperidin-3-yl]pyridine |
| SMILES | Cc1cccc(Cc2cccc([C@H]3CCCN(Cc4ccccn4)C3)n2)c1 |
| InChI | InChI=1S/C24H27N3/c1-19-7-4-8-20(15-19)16-22-11-5-12-24(26-22)21-9-6-14-27(17-21)18-23-10-2-3-13-25-23/h2-5,7-8,10-13,15,21H,6,9,14,16-18H2,1H3/t21-/m0/s1 |
| InChIKey | RVGUDWXUKDQVCZ-NRFANRHFSA-N |
| XLogP | 4.76 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |