C23H24FN3 — CID 95809203
2-[(3-fluorophenyl)methyl]-6-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]pyridine (PubChem CID 95809203) has the molecular formula C23H24FN3 and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-6-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]pyridine.
| Compound Name | 2-[(3-fluorophenyl)methyl]-6-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 95809203 |
| Molecular Formula | C23H24FN3 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-6-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]pyridine |
| SMILES | Fc1cccc(Cc2cccc([C@@H]3CCCN(Cc4cccnc4)C3)n2)c1 |
| InChI | InChI=1S/C23H24FN3/c24-21-8-1-5-18(13-21)14-22-9-2-10-23(26-22)20-7-4-12-27(17-20)16-19-6-3-11-25-15-19/h1-3,5-6,8-11,13,15,20H,4,7,12,14,16-17H2/t20-/m1/s1 |
| InChIKey | KFGVDMXOURLCTK-HXUWFJFHSA-N |
| XLogP | 4.59 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |