C21H22FN5 — CID 110248800
5-(3-fluorophenyl)-4-[1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrimidin-2-amine (PubChem CID 110248800) has the molecular formula C21H22FN5 and a molecular weight of 363.44 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-[1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 5-(3-fluorophenyl)-4-[1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 110248800 |
| Molecular Formula | C21H22FN5 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 5-(3-fluorophenyl)-4-[1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2cccc(F)c2)c(C2CCCN(Cc3cccnc3)C2)n1 |
| InChI | InChI=1S/C21H22FN5/c22-18-7-1-5-16(10-18)19-12-25-21(23)26-20(19)17-6-3-9-27(14-17)13-15-4-2-8-24-11-15/h1-2,4-5,7-8,10-12,17H,3,6,9,13-14H2,(H2,23,25,26) |
| InChIKey | OEHXYXMMEAGTNM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |