C22H22F2N4 — CID 95806391
5-(4-fluorophenyl)-4-[(3R)-1-[(4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-2-amine (PubChem CID 95806391) has the molecular formula C22H22F2N4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-[(3R)-1-[(4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 5-(4-fluorophenyl)-4-[(3R)-1-[(4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 95806391 |
| Molecular Formula | C22H22F2N4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 5-(4-fluorophenyl)-4-[(3R)-1-[(4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ccc(F)cc2)c([C@@H]2CCCN(Cc3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C22H22F2N4/c23-18-7-3-15(4-8-18)13-28-11-1-2-17(14-28)21-20(12-26-22(25)27-21)16-5-9-19(24)10-6-16/h3-10,12,17H,1-2,11,13-14H2,(H2,25,26,27)/t17-/m1/s1 |
| InChIKey | MKYIJSUTFFPJJH-QGZVFWFLSA-N |
| XLogP | 4.38 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |