C23H24FN5O — CID 110248773
4-[2-amino-4-[1-[(4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-5-yl]benzamide (PubChem CID 110248773) has the molecular formula C23H24FN5O and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-[2-amino-4-[1-[(4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-5-yl]benzamide.
| Compound Name | 4-[2-amino-4-[1-[(4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 110248773 |
| Molecular Formula | C23H24FN5O |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 4-[2-amino-4-[1-[(4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-5-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cnc(N)nc2C2CCCN(Cc3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C23H24FN5O/c24-19-9-3-15(4-10-19)13-29-11-1-2-18(14-29)21-20(12-27-23(26)28-21)16-5-7-17(8-6-16)22(25)30/h3-10,12,18H,1-2,11,13-14H2,(H2,25,30)(H2,26,27,28) |
| InChIKey | CQLGSAYMSPGHGD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |