C23H25FN4 — CID 110248785
5-(3-fluorophenyl)-4-[1-(2-phenylethyl)piperidin-3-yl]pyrimidin-2-amine (PubChem CID 110248785) has the molecular formula C23H25FN4 and a molecular weight of 376.48 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-[1-(2-phenylethyl)piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 5-(3-fluorophenyl)-4-[1-(2-phenylethyl)piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 110248785 |
| Molecular Formula | C23H25FN4 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 5-(3-fluorophenyl)-4-[1-(2-phenylethyl)piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2cccc(F)c2)c(C2CCCN(CCc3ccccc3)C2)n1 |
| InChI | InChI=1S/C23H25FN4/c24-20-10-4-8-18(14-20)21-15-26-23(25)27-22(21)19-9-5-12-28(16-19)13-11-17-6-2-1-3-7-17/h1-4,6-8,10,14-15,19H,5,9,11-13,16H2,(H2,25,26,27) |
| InChIKey | YGVOTNAVRQLMTM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |