C18H17FN6 — CID 110266907
5-(3-fluorophenyl)-4-(1-pyrimidin-2-ylpyrrolidin-2-yl)pyrimidin-2-amine (PubChem CID 110266907) has the molecular formula C18H17FN6 and a molecular weight of 336.37 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-(1-pyrimidin-2-ylpyrrolidin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-(3-fluorophenyl)-4-(1-pyrimidin-2-ylpyrrolidin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 110266907 |
| Molecular Formula | C18H17FN6 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 5-(3-fluorophenyl)-4-(1-pyrimidin-2-ylpyrrolidin-2-yl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2cccc(F)c2)c(C2CCCN2c2ncccn2)n1 |
| InChI | InChI=1S/C18H17FN6/c19-13-5-1-4-12(10-13)14-11-23-17(20)24-16(14)15-6-2-9-25(15)18-21-7-3-8-22-18/h1,3-5,7-8,10-11,15H,2,6,9H2,(H2,20,23,24) |
| InChIKey | CSMQUJDLCQXRRK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |