C15H17FN4O2S — CID 110253068
5-(3-fluorophenyl)-4-(1-methylsulfonylpyrrolidin-2-yl)pyrimidin-2-amine (PubChem CID 110253068) has the molecular formula C15H17FN4O2S and a molecular weight of 336.39 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-(1-methylsulfonylpyrrolidin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-(3-fluorophenyl)-4-(1-methylsulfonylpyrrolidin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 110253068 |
| Molecular Formula | C15H17FN4O2S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-(3-fluorophenyl)-4-(1-methylsulfonylpyrrolidin-2-yl)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCCC1c1nc(N)ncc1-c1cccc(F)c1 |
| InChI | InChI=1S/C15H17FN4O2S/c1-23(21,22)20-7-3-6-13(20)14-12(9-18-15(17)19-14)10-4-2-5-11(16)8-10/h2,4-5,8-9,13H,3,6-7H2,1H3,(H2,17,18,19) |
| InChIKey | LULGDGJNVZRHHH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |