C19H21FN6O2S — CID 110267000
5-(3-fluorophenyl)-4-[1-(1-methylimidazol-4-yl)sulfonylpiperidin-2-yl]pyrimidin-2-amine (PubChem CID 110267000) has the molecular formula C19H21FN6O2S and a molecular weight of 416.48 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-[1-(1-methylimidazol-4-yl)sulfonylpiperidin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-(3-fluorophenyl)-4-[1-(1-methylimidazol-4-yl)sulfonylpiperidin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 110267000 |
| Molecular Formula | C19H21FN6O2S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5-(3-fluorophenyl)-4-[1-(1-methylimidazol-4-yl)sulfonylpiperidin-2-yl]pyrimidin-2-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2CCCCC2c2nc(N)ncc2-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H21FN6O2S/c1-25-11-17(23-12-25)29(27,28)26-8-3-2-7-16(26)18-15(10-22-19(21)24-18)13-5-4-6-14(20)9-13/h4-6,9-12,16H,2-3,7-8H2,1H3,(H2,21,22,24) |
| InChIKey | CYQFGZSVPSFEPT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |