C17H20FN5O — CID 118740239
2-[2-[2-amino-5-(3-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]acetamide (PubChem CID 118740239) has the molecular formula C17H20FN5O and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-[2-[2-amino-5-(3-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]acetamide.
| Compound Name | 2-[2-[2-amino-5-(3-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 118740239 |
| Molecular Formula | C17H20FN5O |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[2-[2-amino-5-(3-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCCC1c1nc(N)ncc1-c1cccc(F)c1 |
| InChI | InChI=1S/C17H20FN5O/c18-12-5-3-4-11(8-12)13-9-21-17(20)22-16(13)14-6-1-2-7-23(14)10-15(19)24/h3-5,8-9,14H,1-2,6-7,10H2,(H2,19,24)(H2,20,21,22) |
| InChIKey | MKHLTWRVUVRZGF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |