C21H21FN4O2S — CID 110253120
4-(1-benzylsulfonylpyrrolidin-2-yl)-5-(4-fluorophenyl)pyrimidin-2-amine (PubChem CID 110253120) has the molecular formula C21H21FN4O2S and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-(1-benzylsulfonylpyrrolidin-2-yl)-5-(4-fluorophenyl)pyrimidin-2-amine.
| Compound Name | 4-(1-benzylsulfonylpyrrolidin-2-yl)-5-(4-fluorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 110253120 |
| Molecular Formula | C21H21FN4O2S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-(1-benzylsulfonylpyrrolidin-2-yl)-5-(4-fluorophenyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ccc(F)cc2)c(C2CCCN2S(=O)(=O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H21FN4O2S/c22-17-10-8-16(9-11-17)18-13-24-21(23)25-20(18)19-7-4-12-26(19)29(27,28)14-15-5-2-1-3-6-15/h1-3,5-6,8-11,13,19H,4,7,12,14H2,(H2,23,24,25) |
| InChIKey | RXBNVDIUPFEBPA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |