C23H23FN4O — CID 110253077
1-[2-[2-amino-5-(4-fluorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-3-phenylpropan-1-one (PubChem CID 110253077) has the molecular formula C23H23FN4O and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[2-[2-amino-5-(4-fluorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[2-[2-amino-5-(4-fluorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 110253077 |
| Molecular Formula | C23H23FN4O |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[2-[2-amino-5-(4-fluorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-3-phenylpropan-1-one |
| SMILES | Nc1ncc(-c2ccc(F)cc2)c(C2CCCN2C(=O)CCc2ccccc2)n1 |
| InChI | InChI=1S/C23H23FN4O/c24-18-11-9-17(10-12-18)19-15-26-23(25)27-22(19)20-7-4-14-28(20)21(29)13-8-16-5-2-1-3-6-16/h1-3,5-6,9-12,15,20H,4,7-8,13-14H2,(H2,25,26,27) |
| InChIKey | OMDLZMKEVUGLCJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |