C25H24F2N2O — CID 110249685
2-(4-fluorophenyl)-1-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]ethanone (PubChem CID 110249685) has the molecular formula C25H24F2N2O and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110249685 |
| Molecular Formula | C25H24F2N2O |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCCC(c2cccc(Cc3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C25H24F2N2O/c26-21-11-9-18(10-12-21)16-25(30)29-13-3-5-20(17-29)24-8-2-7-23(28-24)15-19-4-1-6-22(27)14-19/h1-2,4,6-12,14,20H,3,5,13,15-17H2 |
| InChIKey | KEALCWBBQKPXIG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |