C24H24FN3O — CID 95809788
1-[(3S)-3-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-pyridin-4-ylethanone (PubChem CID 95809788) has the molecular formula C24H24FN3O and a molecular weight of 389.47 g/mol. Its IUPAC name is 1-[(3S)-3-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[(3S)-3-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 95809788 |
| Molecular Formula | C24H24FN3O |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[(3S)-3-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-pyridin-4-ylethanone |
| SMILES | O=C(Cc1ccncc1)N1CCC[C@H](c2cccc(Cc3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C24H24FN3O/c25-21-8-6-18(7-9-21)15-22-4-1-5-23(27-22)20-3-2-14-28(17-20)24(29)16-19-10-12-26-13-11-19/h1,4-13,20H,2-3,14-17H2/t20-/m0/s1 |
| InChIKey | YXMGUOZXOQBWDQ-FQEVSTJZSA-N |
| XLogP | 4.16 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |