C25H25FN2O — CID 95809941
1-[4-(6-benzyl-2-pyridinyl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 95809941) has the molecular formula C25H25FN2O and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[4-(6-benzyl-2-pyridinyl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[4-(6-benzyl-2-pyridinyl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 95809941 |
| Molecular Formula | C25H25FN2O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[4-(6-benzyl-2-pyridinyl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCC(c2cccc(Cc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C25H25FN2O/c26-22-11-9-20(10-12-22)18-25(29)28-15-13-21(14-16-28)24-8-4-7-23(27-24)17-19-5-2-1-3-6-19/h1-12,21H,13-18H2 |
| InChIKey | VHQXIKFTEPCVQS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |