C27H26FN3O — CID 110085536
1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-(1H-indol-3-yl)ethanone (PubChem CID 110085536) has the molecular formula C27H26FN3O and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-(1H-indol-3-yl)ethanone.
| Compound Name | 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 110085536 |
| Molecular Formula | C27H26FN3O |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-(1H-indol-3-yl)ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCC(c2cccc(Cc3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C27H26FN3O/c28-22-10-8-19(9-11-22)16-23-4-3-7-25(30-23)20-12-14-31(15-13-20)27(32)17-21-18-29-26-6-2-1-5-24(21)26/h1-11,18,20,29H,12-17H2 |
| InChIKey | RWDAGINISOMPFQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |