C26H24ClN3O — CID 155985300
1-[2-[6-[(2-chlorophenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]-2-(1H-indol-3-yl)ethanone (PubChem CID 155985300) has the molecular formula C26H24ClN3O and a molecular weight of 429.95 g/mol. Its IUPAC name is 1-[2-[6-[(2-chlorophenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]-2-(1H-indol-3-yl)ethanone.
| Compound Name | 1-[2-[6-[(2-chlorophenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]-2-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 155985300 |
| Molecular Formula | C26H24ClN3O |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 1-[2-[6-[(2-chlorophenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]-2-(1H-indol-3-yl)ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCCC1c1cccc(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C26H24ClN3O/c27-22-10-3-1-7-18(22)15-20-8-5-12-24(29-20)25-13-6-14-30(25)26(31)16-19-17-28-23-11-4-2-9-21(19)23/h1-5,7-12,17,25,28H,6,13-16H2 |
| InChIKey | TWXUYUHWXBJGDE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |