C22H20ClN3O — CID 95818042
[(2S)-2-[6-[(2-chlorophenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 95818042) has the molecular formula C22H20ClN3O and a molecular weight of 377.88 g/mol. Its IUPAC name is [(2S)-2-[6-[(2-chlorophenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(2S)-2-[6-[(2-chlorophenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 95818042 |
| Molecular Formula | C22H20ClN3O |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [(2S)-2-[6-[(2-chlorophenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCC[C@H]1c1cccc(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C22H20ClN3O/c23-19-9-2-1-6-16(19)14-18-8-3-10-20(25-18)21-11-5-13-26(21)22(27)17-7-4-12-24-15-17/h1-4,6-10,12,15,21H,5,11,13-14H2/t21-/m0/s1 |
| InChIKey | LRJRXQVDLONQMX-NRFANRHFSA-N |
| XLogP | 4.70 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |