C23H22FN3O — CID 95809453
[4-[6-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 95809453) has the molecular formula C23H22FN3O and a molecular weight of 375.45 g/mol. Its IUPAC name is [4-[6-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [4-[6-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 95809453 |
| Molecular Formula | C23H22FN3O |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | [4-[6-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCC(c2cccc(Cc3ccccc3F)n2)CC1 |
| InChI | InChI=1S/C23H22FN3O/c24-21-8-2-1-5-18(21)15-20-7-3-9-22(26-20)17-10-13-27(14-11-17)23(28)19-6-4-12-25-16-19/h1-9,12,16-17H,10-11,13-15H2 |
| InChIKey | DFJWRALVWPCZKZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |