C19H21FN2O — CID 95817811
1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]ethanone (PubChem CID 95817811) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95817811 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2cccc(Cc3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C19H21FN2O/c1-14(23)22-11-9-16(10-12-22)19-4-2-3-18(21-19)13-15-5-7-17(20)8-6-15/h2-8,16H,9-13H2,1H3 |
| InChIKey | MYUBFHYDUHKMDC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |