C17H19FN2 — CID 110254377
2-[(4-fluorophenyl)methyl]-6-(1-methylpyrrolidin-2-yl)pyridine (PubChem CID 110254377) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-6-(1-methylpyrrolidin-2-yl)pyridine.
| Compound Name | 2-[(4-fluorophenyl)methyl]-6-(1-methylpyrrolidin-2-yl)pyridine |
|---|---|
| PubChem CID | 110254377 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-6-(1-methylpyrrolidin-2-yl)pyridine |
| SMILES | CN1CCCC1c1cccc(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H19FN2/c1-20-11-3-6-17(20)16-5-2-4-15(19-16)12-13-7-9-14(18)10-8-13/h2,4-5,7-10,17H,3,6,11-12H2,1H3 |
| InChIKey | YTACZXAEFUUTDZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |