C10H13BrN2 — CID 124641952
2-bromo-6-[(2R)-1-methylpyrrolidin-2-yl]pyridine (PubChem CID 124641952) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 2-bromo-6-[(2R)-1-methylpyrrolidin-2-yl]pyridine.
| Compound Name | 2-bromo-6-[(2R)-1-methylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 124641952 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 2-bromo-6-[(2R)-1-methylpyrrolidin-2-yl]pyridine |
| SMILES | CN1CCC[C@@H]1c1cccc(Br)n1 |
| InChI | InChI=1S/C10H13BrN2/c1-13-7-3-5-9(13)8-4-2-6-10(11)12-8/h2,4,6,9H,3,5,7H2,1H3/t9-/m1/s1 |
| InChIKey | PHJQTOONVCTRCS-SECBINFHSA-N |
| XLogP | 2.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|