C8H12N2S — CID 143153913
4-(1-methylpyrrolidin-2-yl)-1,3-thiazole (PubChem CID 143153913) has the molecular formula C8H12N2S and a molecular weight of 168.27 g/mol. Its IUPAC name is 4-(1-methylpyrrolidin-2-yl)-1,3-thiazole.
| Compound Name | 4-(1-methylpyrrolidin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 143153913 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.27 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 4-(1-methylpyrrolidin-2-yl)-1,3-thiazole |
| SMILES | CN1CCCC1c1cscn1 |
| InChI | InChI=1S/C8H12N2S/c1-10-4-2-3-8(10)7-5-11-6-9-7/h5-6,8H,2-4H2,1H3 |
| InChIKey | PZWXZKXTNIHCOU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |