C8H13N3O — CID 115013289
4-(1-methylpyrrolidin-2-yl)-1,3-oxazol-2-amine (PubChem CID 115013289) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-(1-methylpyrrolidin-2-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-(1-methylpyrrolidin-2-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 115013289 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 4-(1-methylpyrrolidin-2-yl)-1,3-oxazol-2-amine |
| SMILES | CN1CCCC1c1coc(N)n1 |
| InChI | InChI=1S/C8H13N3O/c1-11-4-2-3-7(11)6-5-12-8(9)10-6/h5,7H,2-4H2,1H3,(H2,9,10) |
| InChIKey | CESAQTMMGARKIQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |