C10H16N4 — CID 59551929
4-methyl-6-(1-methylpyrrolidin-2-yl)pyrimidin-2-amine (PubChem CID 59551929) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 4-methyl-6-(1-methylpyrrolidin-2-yl)pyrimidin-2-amine.
| Compound Name | 4-methyl-6-(1-methylpyrrolidin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59551929 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 4-methyl-6-(1-methylpyrrolidin-2-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(C2CCCN2C)nc(N)n1 |
| InChI | InChI=1S/C10H16N4/c1-7-6-8(13-10(11)12-7)9-4-3-5-14(9)2/h6,9H,3-5H2,1-2H3,(H2,11,12,13) |
| InChIKey | LFCBOYDHBITCRJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |