C17H19FN2O2S — CID 95817970
2-[(4-fluorophenyl)methyl]-6-[(2R)-1-methylsulfonylpyrrolidin-2-yl]pyridine (PubChem CID 95817970) has the molecular formula C17H19FN2O2S and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-6-[(2R)-1-methylsulfonylpyrrolidin-2-yl]pyridine.
| Compound Name | 2-[(4-fluorophenyl)methyl]-6-[(2R)-1-methylsulfonylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 95817970 |
| Molecular Formula | C17H19FN2O2S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-6-[(2R)-1-methylsulfonylpyrrolidin-2-yl]pyridine |
| SMILES | CS(=O)(=O)N1CCC[C@@H]1c1cccc(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H19FN2O2S/c1-23(21,22)20-11-3-6-17(20)16-5-2-4-15(19-16)12-13-7-9-14(18)10-8-13/h2,4-5,7-10,17H,3,6,11-12H2,1H3/t17-/m1/s1 |
| InChIKey | DZQIASCQGWLVSL-QGZVFWFLSA-N |
| XLogP | 2.91 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |