C23H28N2O — CID 95818236
cyclopentyl-[(2S)-2-[6-[(4-methylphenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]methanone (PubChem CID 95818236) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is cyclopentyl-[(2S)-2-[6-[(4-methylphenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]methanone.
| Compound Name | cyclopentyl-[(2S)-2-[6-[(4-methylphenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95818236 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | cyclopentyl-[(2S)-2-[6-[(4-methylphenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc(Cc2cccc([C@@H]3CCCN3C(=O)C3CCCC3)n2)cc1 |
| InChI | InChI=1S/C23H28N2O/c1-17-11-13-18(14-12-17)16-20-8-4-9-21(24-20)22-10-5-15-25(22)23(26)19-6-2-3-7-19/h4,8-9,11-14,19,22H,2-3,5-7,10,15-16H2,1H3/t22-/m0/s1 |
| InChIKey | DPEJFHNKRJXLMS-QFIPXVFZSA-N |
| XLogP | 4.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |