C21H21FN4O — CID 95810149
[4-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 95810149) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is [4-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [4-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 95810149 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [4-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccn[nH]1)N1CCC(c2cccc(Cc3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C21H21FN4O/c22-17-4-1-3-15(13-17)14-18-5-2-6-19(24-18)16-8-11-26(12-9-16)21(27)20-7-10-23-25-20/h1-7,10,13,16H,8-9,11-12,14H2,(H,23,25) |
| InChIKey | VYUHNBORHMVVIC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |