C25H25FN2O2 — CID 95809413
1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-phenoxyethanone (PubChem CID 95809413) has the molecular formula C25H25FN2O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 95809413 |
| Molecular Formula | C25H25FN2O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-[4-[6-[(4-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCC(c2cccc(Cc3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C25H25FN2O2/c26-21-11-9-19(10-12-21)17-22-5-4-8-24(27-22)20-13-15-28(16-14-20)25(29)18-30-23-6-2-1-3-7-23/h1-12,20H,13-18H2 |
| InChIKey | FRYFHOFBSLETCW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |