C14H15N5O — CID 95845020
[(2R)-2-(2-aminopyrimidin-4-yl)pyrrolidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 95845020) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is [(2R)-2-(2-aminopyrimidin-4-yl)pyrrolidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(2R)-2-(2-aminopyrimidin-4-yl)pyrrolidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 95845020 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | [(2R)-2-(2-aminopyrimidin-4-yl)pyrrolidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | Nc1nccc([C@H]2CCCN2C(=O)c2cccnc2)n1 |
| InChI | InChI=1S/C14H15N5O/c15-14-17-7-5-11(18-14)12-4-2-8-19(12)13(20)10-3-1-6-16-9-10/h1,3,5-7,9,12H,2,4,8H2,(H2,15,17,18)/t12-/m1/s1 |
| InChIKey | QCJDNRORHNYBDG-GFCCVEGCSA-N |
| XLogP | 1.43 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |