C22H27N5O2 — CID 95823426
2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-6-(2-methoxyphenoxy)pyrazine (PubChem CID 95823426) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-6-(2-methoxyphenoxy)pyrazine.
| Compound Name | 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-6-(2-methoxyphenoxy)pyrazine |
|---|---|
| PubChem CID | 95823426 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-6-(2-methoxyphenoxy)pyrazine |
| SMILES | CCn1ccnc1CN1CCC[C@H](c2cncc(Oc3ccccc3OC)n2)C1 |
| InChI | InChI=1S/C22H27N5O2/c1-3-27-12-10-24-21(27)16-26-11-6-7-17(15-26)18-13-23-14-22(25-18)29-20-9-5-4-8-19(20)28-2/h4-5,8-10,12-14,17H,3,6-7,11,15-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | GALJSVSJUFAVGG-KRWDZBQOSA-N |
| XLogP | 3.87 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |