C20H23N5O2 — CID 124950353
2-[(3S)-1-(1H-imidazol-5-ylmethyl)piperidin-3-yl]-6-(3-methoxyphenoxy)pyrazine (PubChem CID 124950353) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[(3S)-1-(1H-imidazol-5-ylmethyl)piperidin-3-yl]-6-(3-methoxyphenoxy)pyrazine.
| Compound Name | 2-[(3S)-1-(1H-imidazol-5-ylmethyl)piperidin-3-yl]-6-(3-methoxyphenoxy)pyrazine |
|---|---|
| PubChem CID | 124950353 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[(3S)-1-(1H-imidazol-5-ylmethyl)piperidin-3-yl]-6-(3-methoxyphenoxy)pyrazine |
| SMILES | COc1cccc(Oc2cncc([C@H]3CCCN(Cc4cnc[nH]4)C3)n2)c1 |
| InChI | InChI=1S/C20H23N5O2/c1-26-17-5-2-6-18(8-17)27-20-11-21-10-19(24-20)15-4-3-7-25(12-15)13-16-9-22-14-23-16/h2,5-6,8-11,14-15H,3-4,7,12-13H2,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | DBFJJIYIKJUZLV-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |